Check if the input protein sequence or molecule SMILES string is valid.
Scanned 9/11/2026
Install to Claude Code
npx -y skills add InternScience/DrClaw --skill drugsda-data-valid --agent claude-codeInstalls into .claude/skills of the current project.
Are you the author of Drugsda Data Valid?
Add the live security badge to your README — it updates automatically with every re-scan.
[](https://www.skillsdirectory.com/skills/internscience-drugsda-data-valid-4b230450)More formats (shields.io, HTML) on the badges page.
---
name: drugsda-data-valid
description: Check if the input protein sequence or molecule SMILES string is valid.
license: MIT license
metadata:
skill-author: PJLab
i18n:
zh:
description: 检查蛋白质序列或SMILES有。
---
# Protein or Molecule Data Check
## Usage
### 1. MCP Server Definition
```python
import json
from mcp.client.streamable_http import streamablehttp_client
from mcp import ClientSession
class DrugSDAClient:
def __init__(self, server_url: str):
self.server_url = server_url
self.session = None
async def connect(self):
print(f"server url: {self.server_url}")
try:
self.transport = streamablehttp_client(
url=self.server_url,
headers={"SCP-HUB-API-KEY": "sk-a0033dde-b3cd-413b-adbe-980bc78d6126"}
)
self.read, self.write, self.get_session_id = await self.transport.__aenter__()
self.session_ctx = ClientSession(self.read, self.write)
self.session = await self.session_ctx.__aenter__()
await self.session.initialize()
session_id = self.get_session_id()
print(f"✓ connect success")
return True
except Exception as e:
print(f"✗ connect failure: {e}")
import traceback
traceback.print_exc()
return False
async def disconnect(self):
try:
if self.session:
await self.session_ctx.__aexit__(None, None, None)
if hasattr(self, 'transport'):
await self.transport.__aexit__(None, None, None)
print("✓ already disconnect")
except Exception as e:
print(f"✗ disconnect error: {e}")
def parse_result(self, result):
try:
if hasattr(result, 'content') and result.content:
content = result.content[0]
if hasattr(content, 'text'):
return json.loads(content.text)
return str(result)
except Exception as e:
return {"error": f"parse error: {e}", "raw": str(result)}
```
### 2. Protein Sequence Valid Check
The description of tool *is_valid_protein_sequence*.
```tex
Check if the input protein sequence string is valid.
Args:
sequences (List[str]): List of input protein sequences
Return:
status (str): success/partial_success/error
msg (str): message
valid_res (List[dict]): List of dict, each containing the keys 'sequence' and 'is_valid'.
--sequence (str): A protein sequence of the input sequences list
--is_valid (bool): Is the protein sequence valid or not
```
How to use tool *is_valid_protein_sequence* :
```python
client = DrugSDAClient("https://scp.intern-ai.org.cn/api/v1/mcp/2/DrugSDA-Tool")
if not await client.connect():
print("connection failed")
return
response = await client.session.call_tool(
"is_valid_protein_sequence",
arguments={
"sequences": sequence_list
}
)
result = client.parse_result(response)
valid_res = result["valid_res"]
await client.disconnect()
```
### 3. Molecule SMILCES Valid Check
The description of tool *is_valid_smiles*.
```tex
Check if the input SMILES string is valid
Args:
smiles_list (List[str]): List of input SMILES strings, (e.g., ["N[C@@H](Cc1ccc(O)cc1)C(=O)O", "CC(C)C1=CC=CC=C1"])
Return:
status (str): success/partial_success/error
msg (str): message
valid_res (List[dict]): List of dict, each containing the keys 'smiles' and 'is_valid'.
--smiles (str): A SMILES string of smiles_list
--is_valid (bool): Is the SMILES valid or not
```
How to use tool *is_valid_smiles* :
```python
client = DrugSDAClient("https://scp.intern-ai.org.cn/api/v1/mcp/2/DrugSDA-Tool")
if not await client.connect():
print("connection failed")
return
response = await client.session.call_tool(
"is_valid_smiles",
arguments={
"smiles_list": smiles_list
}
)
result = client.parse_result(response)
valid_res = result["valid_res"]
await client.disconnect()
```
Is this your skill, or is something wrong with this listing? Request removal or report an issue. Author removals are honored within 72 hours.
No comments yet. Be the first to comment!