Open-weights chemistry reasoning model + verifiable reward functions from FutureHouse's ether0 (arXiv 2506.17238). Use to score model-generated chemistry outputs (SMILES validity, molecular completion, synthesis reasoning) against ground truth, or to run the open-weights ether0 model itself for chemistry reasoning. Also useful for visualizing molecules and reactions from SMILES.
Scanned 9/11/2026
Install to Claude Code
npx -y skills add qhjqhj00/research-skills-pool --skill Future-House--ether0--ether0-chemistry-rewards --agent claude-codeInstalls into .claude/skills of the current project.
Are you the author of Future House Ether0 Ether0 Chemistry Rewards?
Add the live security badge to your README — it updates automatically with every re-scan.
[](https://www.skillsdirectory.com/skills/qhjqhj00-future-house-ether0-ether0-chemistry-rewards)More formats (shields.io, HTML) on the badges page.
---
name: ether0-chemistry-rewards
description: Open-weights chemistry reasoning model + verifiable reward functions from FutureHouse's ether0 (arXiv 2506.17238). Use to score model-generated chemistry outputs (SMILES validity, molecular completion, synthesis reasoning) against ground truth, or to run the open-weights ether0 model itself for chemistry reasoning. Also useful for visualizing molecules and reactions from SMILES.
metadata:
skill-author: Compiled from FutureHouse ether0 (Apache-2.0)
upstream: https://github.com/Future-House/ether0
---
# ether0 — Chemistry Reasoning Model & Reward Functions
ether0 is FutureHouse's open-weights chemistry reasoning model, trained via SFT + RLVR (reinforcement learning with verifiable rewards) on a curated chemistry benchmark. The companion repo ships the **reward functions** used during training — directly usable for grading any chemistry-LLM output against ground truth.
Use this skill for:
- **Scoring** chemistry model outputs (e.g. evaluating GPT-4 / Claude on the ether0 benchmark)
- **Running the ether0 model** itself for chemistry reasoning (open-weights on Hugging Face)
- **Drawing molecules and reactions** from SMILES via `ether0.data.draw_molecule` / `draw_reaction`
- **Building your own chemistry RL training loop** (the rewards are the verifiable component)
Resources:
- Paper: <https://arxiv.org/abs/2506.17238>
- Model: <https://huggingface.co/futurehouse/ether0>
- Benchmark: <https://huggingface.co/datasets/futurehouse/ether0-benchmark>
## Install
```bash
pip install git+https://github.com/Future-House/ether0.git
# or
git clone https://github.com/Future-House/ether0.git && cd ether0 && uv sync
```
Python 3.11+, Apache-2.0.
## Recipes
### Score a model's molecular completion
```python
from ether0.rewards import valid_mol_eval
partial = "O=C(OC1C(OC(=O)C=2C=CC=CC2)C3(O)C(C)(C)CCCC3(C)C4CC=5OC=CC5C(C)C14"
good_completion = ")C=6C=CC=CC6"
bad_completion = "CCC"
assert valid_mol_eval(good_completion, partial) # True
assert not valid_mol_eval(bad_completion, partial) # False — invalid SMILES
```
The full reward suite lives in `ether0.rewards` and covers tasks like SMILES validity, exact-match products, structural similarity, atom-economy of proposed reactions, etc.
### Visualize a molecule
```python
from ether0.data import draw_molecule
svg = draw_molecule("CC(=O)Oc1ccccc1C(=O)O") # aspirin
with open("aspirin.svg", "w") as f:
f.write(svg)
```
In Jupyter:
```python
from IPython.display import SVG
SVG(draw_molecule("c1ccc(cc1)c2ccc(cn2)C#N"))
```
In a terminal: `chafa aspirin.svg`.
### Visualize a reaction
```python
from ether0.data import draw_reaction
svg = draw_reaction("CC1CNCC1c1nc2c(cnn2C(C)C)c(=O)[nH]1.COc1ccc(C=O)cn1>>")
open("rxn.svg", "w").write(svg)
```
### Run the ether0 model directly
```python
from transformers import AutoModelForCausalLM, AutoTokenizer
tok = AutoTokenizer.from_pretrained("futurehouse/ether0")
model = AutoModelForCausalLM.from_pretrained("futurehouse/ether0", device_map="auto")
prompt = "Propose a synthesis route from benzaldehyde to cinnamic acid."
ids = tok(prompt, return_tensors="pt").to(model.device)
out = model.generate(**ids, max_new_tokens=512)
print(tok.decode(out[0], skip_special_tokens=True))
```
Needs ~16 GB VRAM in fp16 (or quantize for smaller). Compatible with vLLM / TGI for production serving.
### Evaluate any LLM on the ether0 benchmark
```python
from datasets import load_dataset
from ether0.rewards import score_response
test = load_dataset("futurehouse/ether0-benchmark", split="test")
scores = []
for row in test.select(range(50)): # first 50 questions
pred = your_llm(row["question"]) # your model under test
scores.append(score_response(pred, row))
print(f"Mean score: {sum(scores)/len(scores):.2f}")
```
## When to use ether0 vs alternatives
| Use case | Pick |
|---|---|
| Score a chemistry model's outputs against ground truth | **ether0.rewards** (this skill) |
| Generate molecules / synthesis routes interactively | Phoenix (hosted) or run ether0 model |
| Render SMILES → SVG quickly with no other deps | `ether0.data.draw_molecule` |
| Train your own chemistry agent with verifiable rewards | ether0 + NeMo-RL or HF TRL |
## Demo-friendly first call
```python
from ether0.data import draw_molecule
open("caffeine.svg", "w").write(draw_molecule("CN1C=NC2=C1C(=O)N(C)C(=O)N2C"))
print("Wrote caffeine.svg")
```
## Caveats
- Repo deliberately ships **rewards + utilities**, not training code. Use NeMo-RL or HF TRL for the SFT/RL phases.
- Some reward functions require `rdkit` (installed transitively); a few "exotic" ones spin up a small remote server (`ether0.remotes`).
- The open-weights ether0 model is research-grade — for production chemistry use Phoenix on the platform.
Is this your skill, or is something wrong with this listing? Request removal or report an issue. Author removals are honored within 72 hours.
No comments yet. Be the first to comment!